1-(3-bromobenzoyl)-3-(5-bromo-2-methoxyphenyl)-5-(2,4-dichlorophenyl)tetrahydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione
Chemical Structure Depiction of
1-(3-bromobenzoyl)-3-(5-bromo-2-methoxyphenyl)-5-(2,4-dichlorophenyl)tetrahydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione
1-(3-bromobenzoyl)-3-(5-bromo-2-methoxyphenyl)-5-(2,4-dichlorophenyl)tetrahydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione
Compound characteristics
| Compound ID: | K257-0050 |
| Compound Name: | 1-(3-bromobenzoyl)-3-(5-bromo-2-methoxyphenyl)-5-(2,4-dichlorophenyl)tetrahydropyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione |
| Molecular Weight: | 654.14 |
| Molecular Formula: | C25 H17 Br2 Cl2 N3 O4 |
| Smiles: | COc1ccc(cc1C1C2C(C(N(C2=O)c2ccc(cc2[Cl])[Cl])=O)N(C(c2cccc(c2)[Br])=O)N1)[Br] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.4698 |
| logD: | 5.4678 |
| logSw: | -6.0625 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.51 |
| InChI Key: | WRTRQZSWPGRWIC-UHFFFAOYSA-N |