2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Chemical Structure Depiction of
2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Compound characteristics
| Compound ID: | K261-0799 |
| Compound Name: | 2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
| Molecular Weight: | 443.86 |
| Molecular Formula: | C20 H14 Cl N3 O5 S |
| Smiles: | C(c1cccc(c1)[N+]([O-])=O)N1C(N(c2ccc(cc2)[Cl])S(c2ccccc12)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7115 |
| logD: | 4.7115 |
| logSw: | -5.0096 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 80.124 |
| InChI Key: | BYAOIQQRMKWZTP-UHFFFAOYSA-N |