2-benzyl-4-[(4-methylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Chemical Structure Depiction of
2-benzyl-4-[(4-methylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
2-benzyl-4-[(4-methylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Compound characteristics
| Compound ID: | K261-1598 |
| Compound Name: | 2-benzyl-4-[(4-methylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
| Molecular Weight: | 392.48 |
| Molecular Formula: | C22 H20 N2 O3 S |
| Smiles: | Cc1ccc(CN2C(N(Cc3ccccc3)S(c3ccccc23)(=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5971 |
| logD: | 4.5971 |
| logSw: | -4.3634 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.959 |
| InChI Key: | XUJSXZNPWRHCNJ-UHFFFAOYSA-N |