2-(3-chlorophenyl)-4-[(2,5-dimethylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Chemical Structure Depiction of
2-(3-chlorophenyl)-4-[(2,5-dimethylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
2-(3-chlorophenyl)-4-[(2,5-dimethylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Compound characteristics
| Compound ID: | K261-1849 |
| Compound Name: | 2-(3-chlorophenyl)-4-[(2,5-dimethylphenyl)methyl]-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
| Molecular Weight: | 426.92 |
| Molecular Formula: | C22 H19 Cl N2 O3 S |
| Smiles: | Cc1ccc(C)c(CN2C(N(c3cccc(c3)[Cl])S(c3ccccc23)(=O)=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.9186 |
| logD: | 5.9186 |
| logSw: | -5.8491 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.743 |
| InChI Key: | XHSMXMVVGSJGLF-UHFFFAOYSA-N |