4-[(4-bromophenyl)methyl]-2-(5-chloro-2-methylphenyl)-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Chemical Structure Depiction of
4-[(4-bromophenyl)methyl]-2-(5-chloro-2-methylphenyl)-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
4-[(4-bromophenyl)methyl]-2-(5-chloro-2-methylphenyl)-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione
Compound characteristics
| Compound ID: | K261-2297 |
| Compound Name: | 4-[(4-bromophenyl)methyl]-2-(5-chloro-2-methylphenyl)-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
| Molecular Weight: | 491.79 |
| Molecular Formula: | C21 H16 Br Cl N2 O3 S |
| Smiles: | Cc1ccc(cc1N1C(N(Cc2ccc(cc2)[Br])c2ccccc2S1(=O)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.1553 |
| logD: | 6.1553 |
| logSw: | -5.9435 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.442 |
| InChI Key: | QXXSDLPRNBZZNA-UHFFFAOYSA-N |