4-amino-5-benzoyl-2-(2,6-dimethylanilino)-N-(3-fluorophenyl)thiophene-3-carboxamide
Chemical Structure Depiction of
4-amino-5-benzoyl-2-(2,6-dimethylanilino)-N-(3-fluorophenyl)thiophene-3-carboxamide
4-amino-5-benzoyl-2-(2,6-dimethylanilino)-N-(3-fluorophenyl)thiophene-3-carboxamide
Compound characteristics
| Compound ID: | K264-0156 |
| Compound Name: | 4-amino-5-benzoyl-2-(2,6-dimethylanilino)-N-(3-fluorophenyl)thiophene-3-carboxamide |
| Molecular Weight: | 459.54 |
| Molecular Formula: | C26 H22 F N3 O2 S |
| Smiles: | Cc1cccc(C)c1Nc1c(C(Nc2cccc(c2)F)=O)c(c(C(c2ccccc2)=O)s1)N |
| Stereo: | ACHIRAL |
| logP: | 5.8598 |
| logD: | 5.8598 |
| logSw: | -5.6648 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 63.494 |
| InChI Key: | ANLVWYUTSOXPJX-UHFFFAOYSA-N |