[3-amino-5-(2-ethoxyanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](4-chlorophenyl)methanone
Chemical Structure Depiction of
[3-amino-5-(2-ethoxyanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](4-chlorophenyl)methanone
[3-amino-5-(2-ethoxyanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](4-chlorophenyl)methanone
Compound characteristics
| Compound ID: | K264-0437 |
| Compound Name: | [3-amino-5-(2-ethoxyanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](4-chlorophenyl)methanone |
| Molecular Weight: | 527.06 |
| Molecular Formula: | C26 H23 Cl N2 O4 S2 |
| Smiles: | CCOc1ccccc1Nc1c(c(c(C(c2ccc(cc2)[Cl])=O)s1)N)S(c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5621 |
| logD: | 6.5621 |
| logSw: | -6.2385 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 77.812 |
| InChI Key: | ABNNEWBZFRCJDO-UHFFFAOYSA-N |