N-(2,4-dimethylphenyl)-2,8-dimethyl-3-(3-methylphenyl)-4-sulfanylidene-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-11-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2,8-dimethyl-3-(3-methylphenyl)-4-sulfanylidene-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-11-carboxamide
N-(2,4-dimethylphenyl)-2,8-dimethyl-3-(3-methylphenyl)-4-sulfanylidene-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-11-carboxamide
Compound characteristics
| Compound ID: | K272-1391 |
| Compound Name: | N-(2,4-dimethylphenyl)-2,8-dimethyl-3-(3-methylphenyl)-4-sulfanylidene-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-11-carboxamide |
| Molecular Weight: | 471.62 |
| Molecular Formula: | C28 H29 N3 O2 S |
| Smiles: | Cc1cccc(c1)N1C(NC2C(C(Nc3ccc(C)cc3C)=O)C1(C)Oc1ccc(C)cc12)=S |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.2623 |
| logD: | 6.2615 |
| logSw: | -5.4673 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.906 |
| InChI Key: | WLHXJNXQMPLFKO-UHFFFAOYSA-N |