3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-8-ethoxy-N-(4-methylphenyl)-2H-1-benzopyran-2-imine
Chemical Structure Depiction of
3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-8-ethoxy-N-(4-methylphenyl)-2H-1-benzopyran-2-imine
3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-8-ethoxy-N-(4-methylphenyl)-2H-1-benzopyran-2-imine
Compound characteristics
| Compound ID: | K276-0002 |
| Compound Name: | 3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-8-ethoxy-N-(4-methylphenyl)-2H-1-benzopyran-2-imine |
| Molecular Weight: | 517.44 |
| Molecular Formula: | C27 H21 Br N2 O2 S |
| Smiles: | CCOc1cccc2C=C(/C(=N/c3ccc(C)cc3)Oc12)c1nc(cs1)c1ccc(cc1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 8.0017 |
| logD: | 7.4089 |
| logSw: | -5.936 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.302 |
| InChI Key: | LZXOLMJHDFHNGA-UHFFFAOYSA-N |