2-oxo-3-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]-2H-1-benzopyran-7-yl acetate
Chemical Structure Depiction of
2-oxo-3-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]-2H-1-benzopyran-7-yl acetate
2-oxo-3-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]-2H-1-benzopyran-7-yl acetate
Compound characteristics
| Compound ID: | K277-0100 |
| Compound Name: | 2-oxo-3-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]-2H-1-benzopyran-7-yl acetate |
| Molecular Weight: | 369.42 |
| Molecular Formula: | C18 H11 N O4 S2 |
| Smiles: | CC(=O)Oc1ccc2C=C(C(=O)Oc2c1)c1nc(cs1)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 3.9072 |
| logD: | 3.9072 |
| logSw: | -4.1725 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.392 |
| InChI Key: | CKFNWBWCDCFODA-UHFFFAOYSA-N |