6-{[(2-chlorophenyl)methyl]sulfanyl}-N-[(furan-2-yl)methyl]benzimidazo[1,2-c]quinazoline-3-carboxamide
Chemical Structure Depiction of
6-{[(2-chlorophenyl)methyl]sulfanyl}-N-[(furan-2-yl)methyl]benzimidazo[1,2-c]quinazoline-3-carboxamide
6-{[(2-chlorophenyl)methyl]sulfanyl}-N-[(furan-2-yl)methyl]benzimidazo[1,2-c]quinazoline-3-carboxamide
Compound characteristics
| Compound ID: | K284-1457 |
| Compound Name: | 6-{[(2-chlorophenyl)methyl]sulfanyl}-N-[(furan-2-yl)methyl]benzimidazo[1,2-c]quinazoline-3-carboxamide |
| Molecular Weight: | 498.99 |
| Molecular Formula: | C27 H19 Cl N4 O2 S |
| Smiles: | C(c1ccco1)NC(c1ccc2c(c1)nc(n1c3ccccc3nc12)SCc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.9198 |
| logD: | 6.9188 |
| logSw: | -6.5812 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.98 |
| InChI Key: | ZBJBOQLNKASELD-UHFFFAOYSA-N |