N-(3-chloro-4-methylphenyl)-2-({4-oxo-3-[(thiophen-2-yl)methyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-({4-oxo-3-[(thiophen-2-yl)methyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
N-(3-chloro-4-methylphenyl)-2-({4-oxo-3-[(thiophen-2-yl)methyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | K284-1516 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-({4-oxo-3-[(thiophen-2-yl)methyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 455.98 |
| Molecular Formula: | C22 H18 Cl N3 O2 S2 |
| Smiles: | Cc1ccc(cc1[Cl])NC(CSC1=Nc2ccccc2C(N1Cc1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2121 |
| logD: | 5.212 |
| logSw: | -5.4061 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.939 |
| InChI Key: | JHFZJPLVKFBFAP-UHFFFAOYSA-N |