N-(4-ethylphenyl)-2-({4-oxo-3-[4-oxo-4-(pyrrolidin-1-yl)butyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-2-({4-oxo-3-[4-oxo-4-(pyrrolidin-1-yl)butyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
N-(4-ethylphenyl)-2-({4-oxo-3-[4-oxo-4-(pyrrolidin-1-yl)butyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | K284-4233 |
| Compound Name: | N-(4-ethylphenyl)-2-({4-oxo-3-[4-oxo-4-(pyrrolidin-1-yl)butyl]-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 478.61 |
| Molecular Formula: | C26 H30 N4 O3 S |
| Smiles: | CCc1ccc(cc1)NC(CSC1=Nc2ccccc2C(N1CCCC(N1CCCC1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4721 |
| logD: | 3.4721 |
| logSw: | -3.8213 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.657 |
| InChI Key: | RNITUXAEIUOKNO-UHFFFAOYSA-N |