4-methoxy-N-[2-{[2-(4-methylanilino)-2-oxoethyl]sulfanyl}-4-oxoquinazolin-3(4H)-yl]benzamide
Chemical Structure Depiction of
4-methoxy-N-[2-{[2-(4-methylanilino)-2-oxoethyl]sulfanyl}-4-oxoquinazolin-3(4H)-yl]benzamide
4-methoxy-N-[2-{[2-(4-methylanilino)-2-oxoethyl]sulfanyl}-4-oxoquinazolin-3(4H)-yl]benzamide
Compound characteristics
| Compound ID: | K284-4836 |
| Compound Name: | 4-methoxy-N-[2-{[2-(4-methylanilino)-2-oxoethyl]sulfanyl}-4-oxoquinazolin-3(4H)-yl]benzamide |
| Molecular Weight: | 474.54 |
| Molecular Formula: | C25 H22 N4 O4 S |
| Smiles: | Cc1ccc(cc1)NC(CSC1=Nc2ccccc2C(N1NC(c1ccc(cc1)OC)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0244 |
| logD: | 3.0222 |
| logSw: | -3.7403 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.865 |
| InChI Key: | NONCCKMWLRIHOM-UHFFFAOYSA-N |