2-({3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)-N-(3-methylphenyl)butanamide
Chemical Structure Depiction of
2-({3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)-N-(3-methylphenyl)butanamide
2-({3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)-N-(3-methylphenyl)butanamide
Compound characteristics
| Compound ID: | K284-6046 |
| Compound Name: | 2-({3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)-N-(3-methylphenyl)butanamide |
| Molecular Weight: | 577.7 |
| Molecular Formula: | C31 H35 N3 O6 S |
| Smiles: | CCC(C(Nc1cccc(C)c1)=O)SC1=Nc2cc(c(cc2C(N1CCc1ccc(c(c1)OC)OC)=O)OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4076 |
| logD: | 5.4076 |
| logSw: | -5.3036 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.634 |
| InChI Key: | GKIKCOUZQDEDTE-NDEPHWFRSA-N |