N-(4-fluorophenyl)-2-({3-[(4-methoxyphenyl)methyl]-6-(morpholin-4-yl)-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-({3-[(4-methoxyphenyl)methyl]-6-(morpholin-4-yl)-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
N-(4-fluorophenyl)-2-({3-[(4-methoxyphenyl)methyl]-6-(morpholin-4-yl)-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | K284-6874 |
| Compound Name: | N-(4-fluorophenyl)-2-({3-[(4-methoxyphenyl)methyl]-6-(morpholin-4-yl)-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 534.61 |
| Molecular Formula: | C28 H27 F N4 O4 S |
| Smiles: | COc1ccc(CN2C(=Nc3ccc(cc3C2=O)N2CCOCC2)SCC(Nc2ccc(cc2)F)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.0334 |
| logD: | 4.0333 |
| logSw: | -4.1574 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.825 |
| InChI Key: | BASWPOSTFONFBF-UHFFFAOYSA-N |