6,7-diethoxy-3-(4-methylcyclohexyl)-2-sulfanylidene-2,3-dihydroquinazolin-4(1H)-one
Chemical Structure Depiction of
6,7-diethoxy-3-(4-methylcyclohexyl)-2-sulfanylidene-2,3-dihydroquinazolin-4(1H)-one
6,7-diethoxy-3-(4-methylcyclohexyl)-2-sulfanylidene-2,3-dihydroquinazolin-4(1H)-one
Compound characteristics
| Compound ID: | K284-7338 |
| Compound Name: | 6,7-diethoxy-3-(4-methylcyclohexyl)-2-sulfanylidene-2,3-dihydroquinazolin-4(1H)-one |
| Molecular Weight: | 362.49 |
| Molecular Formula: | C19 H26 N2 O3 S |
| Smiles: | CCOc1cc2C(N(C3CCC(C)CC3)C(Nc2cc1OCC)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9937 |
| logD: | 3.9858 |
| logSw: | -4.1464 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.96 |
| InChI Key: | ZZBYRVCWDKBRED-UHFFFAOYSA-N |