3-[(4-methylphenyl)methyl]-2-{[(2-methylphenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-[(4-methylphenyl)methyl]-2-{[(2-methylphenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
3-[(4-methylphenyl)methyl]-2-{[(2-methylphenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | K292-0240 |
| Compound Name: | 3-[(4-methylphenyl)methyl]-2-{[(2-methylphenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 392.54 |
| Molecular Formula: | C22 H20 N2 O S2 |
| Smiles: | Cc1ccc(CN2C(=Nc3ccsc3C2=O)SCc2ccccc2C)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.2123 |
| logD: | 6.2123 |
| logSw: | -5.4904 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.7894 |
| InChI Key: | LKFPMRSEXTTYPX-UHFFFAOYSA-N |