3-(4-bromophenyl)-2-{[(3-fluorophenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-(4-bromophenyl)-2-{[(3-fluorophenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
3-(4-bromophenyl)-2-{[(3-fluorophenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | K292-0354 |
| Compound Name: | 3-(4-bromophenyl)-2-{[(3-fluorophenyl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 447.35 |
| Molecular Formula: | C19 H12 Br F N2 O S2 |
| Smiles: | C(c1cccc(c1)F)SC1=Nc2ccsc2C(N1c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4692 |
| logD: | 5.4692 |
| logSw: | -5.8236 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.1779 |
| InChI Key: | CWRIJHOQTCJKJS-UHFFFAOYSA-N |