4-[2-{[2-(4-bromophenyl)-2-oxoethyl]sulfanyl}-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]-N-(2-phenylethyl)butanamide
Chemical Structure Depiction of
4-[2-{[2-(4-bromophenyl)-2-oxoethyl]sulfanyl}-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]-N-(2-phenylethyl)butanamide
4-[2-{[2-(4-bromophenyl)-2-oxoethyl]sulfanyl}-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]-N-(2-phenylethyl)butanamide
Compound characteristics
| Compound ID: | K292-1282 |
| Compound Name: | 4-[2-{[2-(4-bromophenyl)-2-oxoethyl]sulfanyl}-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]-N-(2-phenylethyl)butanamide |
| Molecular Weight: | 570.53 |
| Molecular Formula: | C26 H24 Br N3 O3 S2 |
| Smiles: | C(CC(NCCc1ccccc1)=O)CN1C(=Nc2ccsc2C1=O)SCC(c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.012 |
| logD: | 4.012 |
| logSw: | -4.2334 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.328 |
| InChI Key: | KSKWLLMACWRELK-UHFFFAOYSA-N |