N-[(2-fluorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
Chemical Structure Depiction of
N-[(2-fluorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
N-[(2-fluorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
Compound characteristics
| Compound ID: | K292-1647 |
| Compound Name: | N-[(2-fluorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide |
| Molecular Weight: | 405.51 |
| Molecular Formula: | C19 H20 F N3 O2 S2 |
| Smiles: | C(CCC(NCc1ccccc1F)=O)CCN1C(c2c(ccs2)NC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4148 |
| logD: | 3.4142 |
| logSw: | -3.5811 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.786 |
| InChI Key: | GAPKCJZOCMIQHR-UHFFFAOYSA-N |