2-[(4-{[(4-chlorophenyl)methyl]amino}quinazolin-2-yl)sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-[(4-{[(4-chlorophenyl)methyl]amino}quinazolin-2-yl)sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide
2-[(4-{[(4-chlorophenyl)methyl]amino}quinazolin-2-yl)sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | K297-0146 |
| Compound Name: | 2-[(4-{[(4-chlorophenyl)methyl]amino}quinazolin-2-yl)sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide |
| Molecular Weight: | 495 |
| Molecular Formula: | C25 H23 Cl N4 O3 S |
| Smiles: | COc1ccc(c(c1)NC(CSc1nc(c2ccccc2n1)NCc1ccc(cc1)[Cl])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.2767 |
| logD: | 5.2762 |
| logSw: | -5.9301 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.475 |
| InChI Key: | FSRWYZNLLHLFPW-UHFFFAOYSA-N |