3-(3,4-dimethylphenyl)-N,N-diethyl-5-methyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,2,3,4-tetrahydrothieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
3-(3,4-dimethylphenyl)-N,N-diethyl-5-methyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,2,3,4-tetrahydrothieno[2,3-d]pyrimidine-6-carboxamide
3-(3,4-dimethylphenyl)-N,N-diethyl-5-methyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,2,3,4-tetrahydrothieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K305-0213 |
| Compound Name: | 3-(3,4-dimethylphenyl)-N,N-diethyl-5-methyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,2,3,4-tetrahydrothieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 517.69 |
| Molecular Formula: | C30 H35 N3 O3 S |
| Smiles: | CCN(CC)C(c1c(C)c2C(N(C(N(Cc3c(C)cc(C)cc3C)c2s1)=O)c1ccc(C)c(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.7514 |
| logD: | 6.7514 |
| logSw: | -5.6883 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.039 |
| InChI Key: | AINQMBGYMOEQOY-UHFFFAOYSA-N |