N-butyl-1-(4-chlorophenyl)-N-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-butyl-1-(4-chlorophenyl)-N-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
N-butyl-1-(4-chlorophenyl)-N-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K402-0553 |
| Compound Name: | N-butyl-1-(4-chlorophenyl)-N-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 377.88 |
| Molecular Formula: | C21 H20 Cl N5 |
| Smiles: | CCCCN(c1ccccc1)c1c2cnn(c3ccc(cc3)[Cl])c2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 6.1194 |
| logD: | 6.1191 |
| logSw: | -6.1465 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 36.813 |
| InChI Key: | MLFJURGROPWPFG-UHFFFAOYSA-N |