N-(4-ethylphenyl)-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(4-ethylphenyl)-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
N-(4-ethylphenyl)-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K402-0866 |
| Compound Name: | N-(4-ethylphenyl)-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 315.38 |
| Molecular Formula: | C19 H17 N5 |
| Smiles: | CCc1ccc(cc1)Nc1c2cnn(c3ccccc3)c2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.8778 |
| logD: | 4.8778 |
| logSw: | -4.4598 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.027 |
| InChI Key: | BPHALIMLDSMYIE-UHFFFAOYSA-N |