7-(3-chlorophenyl)-5-phenyl-N-(propan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
7-(3-chlorophenyl)-5-phenyl-N-(propan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
7-(3-chlorophenyl)-5-phenyl-N-(propan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-0262 |
| Compound Name: | 7-(3-chlorophenyl)-5-phenyl-N-(propan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 362.86 |
| Molecular Formula: | C21 H19 Cl N4 |
| Smiles: | [H]N(C(C)C)c1c2c(cn(c3cccc(c3)[Cl])c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.5717 |
| logD: | 5.5468 |
| logSw: | -6.2145 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.947 |
| InChI Key: | NUMIDBANYLUVIS-UHFFFAOYSA-N |