N-(4-ethylphenyl)-5-phenyl-7-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(4-ethylphenyl)-5-phenyl-7-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
N-(4-ethylphenyl)-5-phenyl-7-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-1078 |
| Compound Name: | N-(4-ethylphenyl)-5-phenyl-7-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 458.49 |
| Molecular Formula: | C27 H21 F3 N4 |
| Smiles: | [H]N(c1ccc(CC)cc1)c1c2c(cn(c3cccc(c3)C(F)(F)F)c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 7.7104 |
| logD: | 7.6768 |
| logSw: | -6.3675 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.379 |
| InChI Key: | IYJGHULJNNLUNH-UHFFFAOYSA-N |