4-[4-(4-methoxyphenyl)piperazin-1-yl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidine
Chemical Structure Depiction of
4-[4-(4-methoxyphenyl)piperazin-1-yl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidine
4-[4-(4-methoxyphenyl)piperazin-1-yl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidine
Compound characteristics
| Compound ID: | K405-2550 |
| Compound Name: | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidine |
| Molecular Weight: | 324.38 |
| Molecular Formula: | C17 H20 N6 O |
| Smiles: | Cn1c2c(cn1)c(ncn2)N1CCN(CC1)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.5297 |
| logD: | 2.5263 |
| logSw: | -2.2913 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 49.086 |
| InChI Key: | SISUWJRXRWBAAM-UHFFFAOYSA-N |