N-(3,5-dimethylphenyl)-1-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-1-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
N-(3,5-dimethylphenyl)-1-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-2967 |
| Compound Name: | N-(3,5-dimethylphenyl)-1-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 333.37 |
| Molecular Formula: | C19 H16 F N5 |
| Smiles: | Cc1cc(C)cc(c1)Nc1c2cnn(c3ccc(cc3)F)c2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.7908 |
| logD: | 4.7904 |
| logSw: | -4.5715 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.027 |
| InChI Key: | PLEHPALDSZESEI-UHFFFAOYSA-N |