N-(butan-2-yl)-1-(3-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(butan-2-yl)-1-(3-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
N-(butan-2-yl)-1-(3-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-3699 |
| Compound Name: | N-(butan-2-yl)-1-(3-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 301.78 |
| Molecular Formula: | C15 H16 Cl N5 |
| Smiles: | CCC(C)Nc1c2cnn(c3cccc(c3)[Cl])c2ncn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0436 |
| logD: | 4.0433 |
| logSw: | -4.1109 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.062 |
| InChI Key: | OHCRWPOCZOYTED-JTQLQIEISA-N |