1-(3-chlorophenyl)-N-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
1-(3-chlorophenyl)-N-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
1-(3-chlorophenyl)-N-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-3725 |
| Compound Name: | 1-(3-chlorophenyl)-N-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 339.76 |
| Molecular Formula: | C17 H11 Cl F N5 |
| Smiles: | c1cc(cc(c1)[Cl])n1c2c(cn1)c(Nc1ccc(cc1)F)ncn2 |
| Stereo: | ACHIRAL |
| logP: | 4.7323 |
| logD: | 4.7322 |
| logSw: | -5.0027 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.027 |
| InChI Key: | QOAOQAXBVKLIPC-UHFFFAOYSA-N |