1-(3-chlorophenyl)-4-(4-ethylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine
Chemical Structure Depiction of
1-(3-chlorophenyl)-4-(4-ethylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine
1-(3-chlorophenyl)-4-(4-ethylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine
Compound characteristics
| Compound ID: | K405-3770 |
| Compound Name: | 1-(3-chlorophenyl)-4-(4-ethylpiperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine |
| Molecular Weight: | 342.83 |
| Molecular Formula: | C17 H19 Cl N6 |
| Smiles: | CCN1CCN(CC1)c1c2cnn(c3cccc(c3)[Cl])c2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 3.5557 |
| logD: | 2.9843 |
| logSw: | -3.4256 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.397 |
| InChI Key: | VTKUJYLIOUXTHH-UHFFFAOYSA-N |