N-butyl-1-(2,5-dimethylphenyl)-N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-butyl-1-(2,5-dimethylphenyl)-N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
N-butyl-1-(2,5-dimethylphenyl)-N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | K405-4346 |
| Compound Name: | N-butyl-1-(2,5-dimethylphenyl)-N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Weight: | 309.41 |
| Molecular Formula: | C18 H23 N5 |
| Smiles: | CCCCN(C)c1c2cnn(c3cc(C)ccc3C)c2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.6564 |
| logD: | 4.6258 |
| logSw: | -4.2492 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 37.312 |
| InChI Key: | AIBUEHIMTKNYBZ-UHFFFAOYSA-N |