ethyl 4-({2-[3-(furan-2-yl)prop-2-enoyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methoxy)benzoate
Chemical Structure Depiction of
ethyl 4-({2-[3-(furan-2-yl)prop-2-enoyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methoxy)benzoate
ethyl 4-({2-[3-(furan-2-yl)prop-2-enoyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methoxy)benzoate
Compound characteristics
| Compound ID: | K407-0084 |
| Compound Name: | ethyl 4-({2-[3-(furan-2-yl)prop-2-enoyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methoxy)benzoate |
| Molecular Weight: | 491.54 |
| Molecular Formula: | C28 H29 N O7 |
| Smiles: | CCOC(c1ccc(cc1)OCC1c2cc(c(cc2CCN1C(/C=C/c1ccco1)=O)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4083 |
| logD: | 4.4083 |
| logSw: | -4.2781 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 66.549 |
| InChI Key: | ICHXFZADRXDXOM-DEOSSOPVSA-N |