(2-chloro-5-nitrophenyl){6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydroisoquinolin-2(1H)-yl}methanone
Chemical Structure Depiction of
(2-chloro-5-nitrophenyl){6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydroisoquinolin-2(1H)-yl}methanone
(2-chloro-5-nitrophenyl){6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydroisoquinolin-2(1H)-yl}methanone
Compound characteristics
| Compound ID: | K407-0477 |
| Compound Name: | (2-chloro-5-nitrophenyl){6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydroisoquinolin-2(1H)-yl}methanone |
| Molecular Weight: | 512.95 |
| Molecular Formula: | C26 H25 Cl N2 O7 |
| Smiles: | COc1ccc(cc1)OCC1c2cc(c(cc2CCN1C(c1cc(ccc1[Cl])[N+]([O-])=O)=O)OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6638 |
| logD: | 4.6638 |
| logSw: | -4.9831 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 79.499 |
| InChI Key: | AVVMXXPWQAPUQW-QHCPKHFHSA-N |