2-({1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)-1-(morpholin-4-yl)ethan-1-one
Chemical Structure Depiction of
2-({1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)-1-(morpholin-4-yl)ethan-1-one
2-({1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)-1-(morpholin-4-yl)ethan-1-one
Compound characteristics
| Compound ID: | K413-0270 |
| Compound Name: | 2-({1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)-1-(morpholin-4-yl)ethan-1-one |
| Molecular Weight: | 400.93 |
| Molecular Formula: | C21 H21 Cl N2 O2 S |
| Smiles: | C1COCCN1C(CSc1cn(Cc2ccc(cc2)[Cl])c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6648 |
| logD: | 3.6648 |
| logSw: | -4.1617 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26 |
| InChI Key: | GEGANXCYOAYFFS-UHFFFAOYSA-N |