N-(2H-1,3-benzodioxol-5-yl)-2-({1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2H-1,3-benzodioxol-5-yl)-2-({1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)acetamide
N-(2H-1,3-benzodioxol-5-yl)-2-({1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | K413-0450 |
| Compound Name: | N-(2H-1,3-benzodioxol-5-yl)-2-({1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}sulfanyl)acetamide |
| Molecular Weight: | 450.94 |
| Molecular Formula: | C24 H19 Cl N2 O3 S |
| Smiles: | C(c1ccccc1[Cl])n1cc(c2ccccc12)SCC(Nc1ccc2c(c1)OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4474 |
| logD: | 5.4474 |
| logSw: | -6.0743 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.964 |
| InChI Key: | UWQLOHNSTDJHEM-UHFFFAOYSA-N |