3-(4-bromo-3-methylphenyl)-2-[2-(3,4-difluorophenyl)ethenyl]quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-bromo-3-methylphenyl)-2-[2-(3,4-difluorophenyl)ethenyl]quinazolin-4(3H)-one
3-(4-bromo-3-methylphenyl)-2-[2-(3,4-difluorophenyl)ethenyl]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0252 |
| Compound Name: | 3-(4-bromo-3-methylphenyl)-2-[2-(3,4-difluorophenyl)ethenyl]quinazolin-4(3H)-one |
| Molecular Weight: | 453.28 |
| Molecular Formula: | C23 H15 Br F2 N2 O |
| Smiles: | Cc1cc(ccc1[Br])N1C(/C=C/c2ccc(c(c2)F)F)=Nc2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 5.9044 |
| logD: | 5.9029 |
| logSw: | -5.6074 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.5941 |
| InChI Key: | GWXPDNWBNCYIOI-UHFFFAOYSA-N |