3-(3-chloro-4-methoxyphenyl)-2-{2-[4-(dimethylamino)phenyl]ethenyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(3-chloro-4-methoxyphenyl)-2-{2-[4-(dimethylamino)phenyl]ethenyl}quinazolin-4(3H)-one
3-(3-chloro-4-methoxyphenyl)-2-{2-[4-(dimethylamino)phenyl]ethenyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0294 |
| Compound Name: | 3-(3-chloro-4-methoxyphenyl)-2-{2-[4-(dimethylamino)phenyl]ethenyl}quinazolin-4(3H)-one |
| Molecular Weight: | 431.92 |
| Molecular Formula: | C25 H22 Cl N3 O2 |
| Smiles: | CN(C)c1ccc(/C=C/C2=Nc3ccccc3C(N2c2ccc(c(c2)[Cl])OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5531 |
| logD: | 4.5529 |
| logSw: | -4.7558 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.029 |
| InChI Key: | TXJVVRYTYBFORA-UHFFFAOYSA-N |