3-(4-methoxyphenyl)-2-[2-(naphthalen-1-yl)ethenyl]quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-methoxyphenyl)-2-[2-(naphthalen-1-yl)ethenyl]quinazolin-4(3H)-one
3-(4-methoxyphenyl)-2-[2-(naphthalen-1-yl)ethenyl]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0604 |
| Compound Name: | 3-(4-methoxyphenyl)-2-[2-(naphthalen-1-yl)ethenyl]quinazolin-4(3H)-one |
| Molecular Weight: | 404.47 |
| Molecular Formula: | C27 H20 N2 O2 |
| Smiles: | COc1ccc(cc1)N1C(/C=C/c2cccc3ccccc23)=Nc2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 5.1068 |
| logD: | 5.1059 |
| logSw: | -5.8509 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.866 |
| InChI Key: | QYEOJIXENZAWBK-UHFFFAOYSA-N |