3-(4-bromophenyl)-2-[2-(3-fluorophenyl)ethenyl]quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-bromophenyl)-2-[2-(3-fluorophenyl)ethenyl]quinazolin-4(3H)-one
3-(4-bromophenyl)-2-[2-(3-fluorophenyl)ethenyl]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0643 |
| Compound Name: | 3-(4-bromophenyl)-2-[2-(3-fluorophenyl)ethenyl]quinazolin-4(3H)-one |
| Molecular Weight: | 421.27 |
| Molecular Formula: | C22 H14 Br F N2 O |
| Smiles: | C(=C/c1cccc(c1)F)\C1=Nc2ccccc2C(N1c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.0511 |
| logD: | 5.0508 |
| logSw: | -4.966 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.5941 |
| InChI Key: | SLIHKLNDTMGKNZ-UHFFFAOYSA-N |