3-(3-chloro-4-methylphenyl)-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]benzo[g]quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(3-chloro-4-methylphenyl)-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]benzo[g]quinazolin-4(3H)-one
3-(3-chloro-4-methylphenyl)-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]benzo[g]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0748 |
| Compound Name: | 3-(3-chloro-4-methylphenyl)-2-[2-(2,4,5-trimethoxyphenyl)ethenyl]benzo[g]quinazolin-4(3H)-one |
| Molecular Weight: | 512.99 |
| Molecular Formula: | C30 H25 Cl N2 O4 |
| Smiles: | Cc1ccc(cc1[Cl])N1C(/C=C/c2cc(c(cc2OC)OC)OC)=Nc2cc3ccccc3cc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 6.3793 |
| logD: | 6.3792 |
| logSw: | -6.3632 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.214 |
| InChI Key: | QESGNSYUPJIAEQ-UHFFFAOYSA-N |