7-chloro-3-[3-(trifluoromethyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4(3H)-one
Chemical Structure Depiction of
7-chloro-3-[3-(trifluoromethyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4(3H)-one
7-chloro-3-[3-(trifluoromethyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K505-0814 |
| Compound Name: | 7-chloro-3-[3-(trifluoromethyl)phenyl]-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]quinazolin-4(3H)-one |
| Molecular Weight: | 516.9 |
| Molecular Formula: | C26 H20 Cl F3 N2 O4 |
| Smiles: | COc1cc(/C=C/C2=Nc3cc(ccc3C(N2c2cccc(c2)C(F)(F)F)=O)[Cl])cc(c1OC)OC |
| Stereo: | ACHIRAL |
| logP: | 5.2979 |
| logD: | 5.2977 |
| logSw: | -6.0102 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.572 |
| InChI Key: | YQCXXZFBMHEWQV-UHFFFAOYSA-N |