5-[cyclopentyl(phenyl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-[cyclopentyl(phenyl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
5-[cyclopentyl(phenyl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | K607-0215 |
| Compound Name: | 5-[cyclopentyl(phenyl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 372.39 |
| Molecular Formula: | C21 H19 F3 N2 O |
| Smiles: | C1CCC(C1)C(c1ccccc1)c1nc(c2ccc(cc2)C(F)(F)F)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8146 |
| logD: | 6.8146 |
| logSw: | -6.3831 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.931 |
| InChI Key: | IJTLDPPBOLZVRN-SFHVURJKSA-N |