2-methoxy-6-{[4-(trifluoromethoxy)anilino]methyl}phenol
Chemical Structure Depiction of
2-methoxy-6-{[4-(trifluoromethoxy)anilino]methyl}phenol
2-methoxy-6-{[4-(trifluoromethoxy)anilino]methyl}phenol
Compound characteristics
| Compound ID: | K630-0038 |
| Compound Name: | 2-methoxy-6-{[4-(trifluoromethoxy)anilino]methyl}phenol |
| Molecular Weight: | 313.27 |
| Molecular Formula: | C15 H14 F3 N O3 |
| Smiles: | COc1cccc(CNc2ccc(cc2)OC(F)(F)F)c1O |
| Stereo: | ACHIRAL |
| logP: | 4.5088 |
| logD: | 4.5078 |
| logSw: | -4.4529 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.519 |
| InChI Key: | AGWIHPRDOFRRBE-UHFFFAOYSA-N |