1-(benzenesulfonyl)-2-({[4-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-benzimidazole
Chemical Structure Depiction of
1-(benzenesulfonyl)-2-({[4-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-benzimidazole
1-(benzenesulfonyl)-2-({[4-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-benzimidazole
Compound characteristics
| Compound ID: | K653-0096 |
| Compound Name: | 1-(benzenesulfonyl)-2-({[4-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-benzimidazole |
| Molecular Weight: | 448.48 |
| Molecular Formula: | C21 H15 F3 N2 O2 S2 |
| Smiles: | C(c1ccc(cc1)C(F)(F)F)Sc1nc2ccccc2n1S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5959 |
| logD: | 5.5959 |
| logSw: | -6.0727 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.864 |
| InChI Key: | XYTZNMWYOPEBHT-UHFFFAOYSA-N |