N-[(4-methylphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
N-[(4-methylphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
Compound characteristics
| Compound ID: | K666-0012 |
| Compound Name: | N-[(4-methylphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| Molecular Weight: | 319.4 |
| Molecular Formula: | C14 H13 N3 O2 S2 |
| Smiles: | Cc1ccc(CNS(c2cccc3c2nsn3)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1242 |
| logD: | 3.1092 |
| logSw: | -3.3314 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.949 |
| InChI Key: | GBMAULMSKZESDH-UHFFFAOYSA-N |