{4-[(2,5-difluorophenyl)methanesulfonyl]-3-nitrophenyl}[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{4-[(2,5-difluorophenyl)methanesulfonyl]-3-nitrophenyl}[4-(4-methoxyphenyl)piperazin-1-yl]methanone
{4-[(2,5-difluorophenyl)methanesulfonyl]-3-nitrophenyl}[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | K673-0255 |
| Compound Name: | {4-[(2,5-difluorophenyl)methanesulfonyl]-3-nitrophenyl}[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 531.53 |
| Molecular Formula: | C25 H23 F2 N3 O6 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(c1ccc(c(c1)[N+]([O-])=O)S(Cc1cc(ccc1F)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2757 |
| logD: | 4.2757 |
| logSw: | -4.4017 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 89.536 |
| InChI Key: | QLSOMKZOBPDRSL-UHFFFAOYSA-N |