5-[(3-acetylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione
Chemical Structure Depiction of
5-[(3-acetylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione
5-[(3-acetylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione
Compound characteristics
| Compound ID: | K699-0041 |
| Compound Name: | 5-[(3-acetylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Molecular Weight: | 289.29 |
| Molecular Formula: | C15 H15 N O5 |
| Smiles: | CC(c1cccc(c1)NC=C1C(=O)OC(C)(C)OC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5794 |
| logD: | 0.8633 |
| logSw: | -1.8712 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.872 |
| InChI Key: | HFCNVYIXOOSYQL-UHFFFAOYSA-N |