5-[(4-bromobenzene-1-sulfinyl)methyl]furan-2-carboxylic acid
					Chemical Structure Depiction of
5-[(4-bromobenzene-1-sulfinyl)methyl]furan-2-carboxylic acid
			5-[(4-bromobenzene-1-sulfinyl)methyl]furan-2-carboxylic acid
Compound characteristics
| Compound ID: | K780-1229 | 
| Compound Name: | 5-[(4-bromobenzene-1-sulfinyl)methyl]furan-2-carboxylic acid | 
| Molecular Weight: | 329.17 | 
| Molecular Formula: | C12 H9 Br O4 S | 
| Smiles: | C(c1ccc(C(O)=O)o1)S(c1ccc(cc1)[Br])=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6902 | 
| logD: | -1.2937 | 
| logSw: | -2.7258 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 51.629 | 
| InChI Key: | NIOJPORGOUCBIE-UHFFFAOYSA-N | 
 
				 
				